C28H48O3 — CID 57009682
[2,6-ditert-butyl-4-(3,7-dimethyloctoxy)phenyl] butanoate (PubChem CID 57009682) has the molecular formula C28H48O3 and a molecular weight of 432.69 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-(3,7-dimethyloctoxy)phenyl] butanoate.
| Compound Name | [2,6-ditert-butyl-4-(3,7-dimethyloctoxy)phenyl] butanoate |
|---|---|
| PubChem CID | 57009682 |
| Molecular Formula | C28H48O3 |
| Molecular Weight | 432.69 g/mol |
| Exact Mass | 432.36 |
| IUPAC Name | [2,6-ditert-butyl-4-(3,7-dimethyloctoxy)phenyl] butanoate |
| SMILES | CCCC(=O)Oc1c(C(C)(C)C)cc(OCCC(C)CCCC(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C28H48O3/c1-11-13-25(29)31-26-23(27(5,6)7)18-22(19-24(26)28(8,9)10)30-17-16-21(4)15-12-14-20(2)3/h18-21H,11-17H2,1-10H3 |
| InChIKey | XNGNTBUZEGSYTE-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.69 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|