About [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate
[4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate (PubChem CID 90032600) has the molecular formula C27H44O5
and a molecular weight of 448.64 g/mol. Its IUPAC name is [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate.
Molecular Properties
| Compound Name | [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate |
| PubChem CID | 90032600 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate |
| SMILES | CCCCCCCOc1ccc(OC(=O)CCCC(C)C)c(OC(=O)CCCC(C)C)c1 |
| InChI | InChI=1S/C27H44O5/c1-6-7-8-9-10-19-30-23-17-18-24(31-26(28)15-11-13-21(2)3)25(20-23)32-27(29)16-12-14-22(4)5/h17-18,20-22H,6-16,19H2,1-5H3 |
| InChIKey | GIDWYSBWZQUTTB-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate?
The IUPAC name of [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate (CID 90032600) is [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate.
What is the SMILES notation for [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate?
The canonical SMILES for [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate is CCCCCCCOc1ccc(OC(=O)CCCC(C)C)c(OC(=O)CCCC(C)C)c1.
What is the InChIKey of [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate?
The InChIKey is GIDWYSBWZQUTTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H44O5/c1-6-7-8-9-10-19-30-23-17-18-24(31-26(28)15-11-13-21(2)3)25(20-23)32-27(29)16-12-14-22(4)5/h17-18,20-22H,6-16,19H2,1-5H3.
What are the key properties of [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate?
[4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate has a molecular weight of 448.64 g/mol, XLogP of 7.50, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-heptoxy-2-(5-methylhexanoyloxy)phenyl] 5-methylhexanoate is sourced from PubChem (CID 90032600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).