About [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate
[4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate (PubChem CID 90032024) has the molecular formula C19H28O5
and a molecular weight of 336.43 g/mol. Its IUPAC name is [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate.
Molecular Properties
| Compound Name | [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate |
| PubChem CID | 90032024 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate |
| SMILES | COc1ccc(OC(=O)CCC(C)C)c(OC(=O)CCC(C)C)c1 |
| InChI | InChI=1S/C19H28O5/c1-13(2)6-10-18(20)23-16-9-8-15(22-5)12-17(16)24-19(21)11-7-14(3)4/h8-9,12-14H,6-7,10-11H2,1-5H3 |
| InChIKey | VRQDXYSVQSBAMN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate?
The IUPAC name of [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate (CID 90032024) is [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate.
What is the SMILES notation for [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate?
The canonical SMILES for [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate is COc1ccc(OC(=O)CCC(C)C)c(OC(=O)CCC(C)C)c1.
What is the InChIKey of [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate?
The InChIKey is VRQDXYSVQSBAMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O5/c1-13(2)6-10-18(20)23-16-9-8-15(22-5)12-17(16)24-19(21)11-7-14(3)4/h8-9,12-14H,6-7,10-11H2,1-5H3.
What are the key properties of [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate?
[4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate has a molecular weight of 336.43 g/mol, XLogP of 4.38, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methoxy-2-(4-methylpentanoyloxy)phenyl] 4-methylpentanoate is sourced from PubChem (CID 90032024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).