C34H56O6 — CID 177246709
[4-methyl-3,5-bis(4-methyloctanoyloxy)phenyl] 4-methyloctanoate (PubChem CID 177246709) has the molecular formula C34H56O6 and a molecular weight of 560.82 g/mol. Its IUPAC name is [4-methyl-3,5-bis(4-methyloctanoyloxy)phenyl] 4-methyloctanoate.
| Compound Name | [4-methyl-3,5-bis(4-methyloctanoyloxy)phenyl] 4-methyloctanoate |
|---|---|
| PubChem CID | 177246709 |
| Molecular Formula | C34H56O6 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | [4-methyl-3,5-bis(4-methyloctanoyloxy)phenyl] 4-methyloctanoate |
| SMILES | CCCCC(C)CCC(=O)Oc1cc(OC(=O)CCC(C)CCCC)c(C)c(OC(=O)CCC(C)CCCC)c1 |
| InChI | InChI=1S/C34H56O6/c1-8-11-14-25(4)17-20-32(35)38-29-23-30(39-33(36)21-18-26(5)15-12-9-2)28(7)31(24-29)40-34(37)22-19-27(6)16-13-10-3/h23-27H,8-22H2,1-7H3 |
| InChIKey | XFBMKXXQORPBNW-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|