About ethyl (4S)-4-methylnonanoate
ethyl (4S)-4-methylnonanoate (PubChem CID 92950939) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is ethyl (4S)-4-methylnonanoate.
Molecular Properties
| Compound Name | ethyl (4S)-4-methylnonanoate |
| PubChem CID | 92950939 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | ethyl (4S)-4-methylnonanoate |
| SMILES | CCCCC[C@H](C)CCC(=O)OCC |
| InChI | InChI=1S/C12H24O2/c1-4-6-7-8-11(3)9-10-12(13)14-5-2/h11H,4-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | KANLVRWHSMXIIN-NSHDSACASA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4S)-4-methylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S)-4-methylnonanoate?
The IUPAC name of ethyl (4S)-4-methylnonanoate (CID 92950939) is ethyl (4S)-4-methylnonanoate.
What is the SMILES notation for ethyl (4S)-4-methylnonanoate?
The canonical SMILES for ethyl (4S)-4-methylnonanoate is CCCCC[C@H](C)CCC(=O)OCC.
What is the InChIKey of ethyl (4S)-4-methylnonanoate?
The InChIKey is KANLVRWHSMXIIN-NSHDSACASA-N. The full InChI is InChI=1S/C12H24O2/c1-4-6-7-8-11(3)9-10-12(13)14-5-2/h11H,4-10H2,1-3H3/t11-/m0/s1.
What are the key properties of ethyl (4S)-4-methylnonanoate?
ethyl (4S)-4-methylnonanoate has a molecular weight of 200.32 g/mol, XLogP of 3.55, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S)-4-methylnonanoate is sourced from PubChem (CID 92950939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).