C34H54O7 — CID 177246730
[4-formyl-3,5-bis(4-methyloctanoyloxy)phenyl] 4-methyloctanoate (PubChem CID 177246730) has the molecular formula C34H54O7 and a molecular weight of 574.80 g/mol. Its IUPAC name is [4-formyl-3,5-bis(4-methyloctanoyloxy)phenyl] 4-methyloctanoate.
| Compound Name | [4-formyl-3,5-bis(4-methyloctanoyloxy)phenyl] 4-methyloctanoate |
|---|---|
| PubChem CID | 177246730 |
| Molecular Formula | C34H54O7 |
| Molecular Weight | 574.80 g/mol |
| Exact Mass | 574.39 |
| IUPAC Name | [4-formyl-3,5-bis(4-methyloctanoyloxy)phenyl] 4-methyloctanoate |
| SMILES | CCCCC(C)CCC(=O)Oc1cc(OC(=O)CCC(C)CCCC)c(C=O)c(OC(=O)CCC(C)CCCC)c1 |
| InChI | InChI=1S/C34H54O7/c1-7-10-13-25(4)16-19-32(36)39-28-22-30(40-33(37)20-17-26(5)14-11-8-2)29(24-35)31(23-28)41-34(38)21-18-27(6)15-12-9-3/h22-27H,7-21H2,1-6H3 |
| InChIKey | RQVAMTSMWPFIPA-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.80 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|