C43H74O6 — CID 177246683
[3,5-bis(4-ethyldecanoyloxy)-4-methylphenyl] 4-ethyldecanoate (PubChem CID 177246683) has the molecular formula C43H74O6 and a molecular weight of 687.06 g/mol. Its IUPAC name is [3,5-bis(4-ethyldecanoyloxy)-4-methylphenyl] 4-ethyldecanoate.
| Compound Name | [3,5-bis(4-ethyldecanoyloxy)-4-methylphenyl] 4-ethyldecanoate |
|---|---|
| PubChem CID | 177246683 |
| Molecular Formula | C43H74O6 |
| Molecular Weight | 687.06 g/mol |
| Exact Mass | 686.55 |
| IUPAC Name | [3,5-bis(4-ethyldecanoyloxy)-4-methylphenyl] 4-ethyldecanoate |
| SMILES | CCCCCCC(CC)CCC(=O)Oc1cc(OC(=O)CCC(CC)CCCCCC)c(C)c(OC(=O)CCC(CC)CCCCCC)c1 |
| InChI | InChI=1S/C43H74O6/c1-8-14-17-20-23-35(11-4)26-29-41(44)47-38-32-39(48-42(45)30-27-36(12-5)24-21-18-15-9-2)34(7)40(33-38)49-43(46)31-28-37(13-6)25-22-19-16-10-3/h32-33,35-37H,8-31H2,1-7H3 |
| InChIKey | UOJUXCOKGBDSPM-UHFFFAOYSA-N |
| XLogP | 13.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.06 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|