About (3-methoxy-5-methylphenyl) 4-methylnonanoate
(3-methoxy-5-methylphenyl) 4-methylnonanoate (PubChem CID 177246677) has the molecular formula C18H28O3
and a molecular weight of 292.42 g/mol. Its IUPAC name is (3-methoxy-5-methylphenyl) 4-methylnonanoate.
Molecular Properties
| Compound Name | (3-methoxy-5-methylphenyl) 4-methylnonanoate |
| PubChem CID | 177246677 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3-methoxy-5-methylphenyl) 4-methylnonanoate |
| SMILES | CCCCCC(C)CCC(=O)Oc1cc(C)cc(OC)c1 |
| InChI | InChI=1S/C18H28O3/c1-5-6-7-8-14(2)9-10-18(19)21-17-12-15(3)11-16(13-17)20-4/h11-14H,5-10H2,1-4H3 |
| InChIKey | RPXRJZQCJFJQRO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxy-5-methylphenyl) 4-methylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxy-5-methylphenyl) 4-methylnonanoate?
The IUPAC name of (3-methoxy-5-methylphenyl) 4-methylnonanoate (CID 177246677) is (3-methoxy-5-methylphenyl) 4-methylnonanoate.
What is the SMILES notation for (3-methoxy-5-methylphenyl) 4-methylnonanoate?
The canonical SMILES for (3-methoxy-5-methylphenyl) 4-methylnonanoate is CCCCCC(C)CCC(=O)Oc1cc(C)cc(OC)c1.
What is the InChIKey of (3-methoxy-5-methylphenyl) 4-methylnonanoate?
The InChIKey is RPXRJZQCJFJQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O3/c1-5-6-7-8-14(2)9-10-18(19)21-17-12-15(3)11-16(13-17)20-4/h11-14H,5-10H2,1-4H3.
What are the key properties of (3-methoxy-5-methylphenyl) 4-methylnonanoate?
(3-methoxy-5-methylphenyl) 4-methylnonanoate has a molecular weight of 292.42 g/mol, XLogP of 4.91, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxy-5-methylphenyl) 4-methylnonanoate is sourced from PubChem (CID 177246677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).