About [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate
[3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate (PubChem CID 177246646) has the molecular formula C31H52O4
and a molecular weight of 488.75 g/mol. Its IUPAC name is [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate.
Molecular Properties
| Compound Name | [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate |
| PubChem CID | 177246646 |
| Molecular Formula | C31H52O4 |
| Molecular Weight | 488.75 g/mol |
| Exact Mass | 488.39 |
| IUPAC Name | [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate |
| SMILES | CCCCCCCCC(CC)C(=O)Oc1cc(C)cc(OC(=O)C(CC)CCCCCCCC)c1 |
| InChI | InChI=1S/C31H52O4/c1-6-10-12-14-16-18-20-26(8-3)30(32)34-28-22-25(5)23-29(24-28)35-31(33)27(9-4)21-19-17-15-13-11-7-2/h22-24,26-27H,6-21H2,1-5H3 |
| InChIKey | VABLBJFSMXNSBF-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.75 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate?
The IUPAC name of [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate (CID 177246646) is [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate.
What is the SMILES notation for [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate?
The canonical SMILES for [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate is CCCCCCCCC(CC)C(=O)Oc1cc(C)cc(OC(=O)C(CC)CCCCCCCC)c1.
What is the InChIKey of [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate?
The InChIKey is VABLBJFSMXNSBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H52O4/c1-6-10-12-14-16-18-20-26(8-3)30(32)34-28-22-25(5)23-29(24-28)35-31(33)27(9-4)21-19-17-15-13-11-7-2/h22-24,26-27H,6-21H2,1-5H3.
What are the key properties of [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate?
[3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate has a molecular weight of 488.75 g/mol, XLogP of 9.36, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-ethyldecanoyloxy)-5-methylphenyl] 2-ethyldecanoate is sourced from PubChem (CID 177246646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).