About [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate
[3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate (PubChem CID 177246749) has the molecular formula C27H44O4
and a molecular weight of 432.65 g/mol. Its IUPAC name is [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate.
Molecular Properties
| Compound Name | [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate |
| PubChem CID | 177246749 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate |
| SMILES | CCCCCCC(C)C(=O)Oc1cc(CC)cc(OC(=O)C(CC)CCCCCC)c1 |
| InChI | InChI=1S/C27H44O4/c1-6-10-12-14-16-21(5)26(28)30-24-18-22(8-3)19-25(20-24)31-27(29)23(9-4)17-15-13-11-7-2/h18-21,23H,6-17H2,1-5H3 |
| InChIKey | OIJSOIWQCXCFHR-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate?
The IUPAC name of [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate (CID 177246749) is [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate.
What is the SMILES notation for [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate?
The canonical SMILES for [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate is CCCCCCC(C)C(=O)Oc1cc(CC)cc(OC(=O)C(CC)CCCCCC)c1.
What is the InChIKey of [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate?
The InChIKey is OIJSOIWQCXCFHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H44O4/c1-6-10-12-14-16-21(5)26(28)30-24-18-22(8-3)19-25(20-24)31-27(29)23(9-4)17-15-13-11-7-2/h18-21,23H,6-17H2,1-5H3.
What are the key properties of [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate?
[3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate has a molecular weight of 432.65 g/mol, XLogP of 7.66, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-ethyl-5-(2-methyloctanoyloxy)phenyl] 2-ethyloctanoate is sourced from PubChem (CID 177246749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).