C54H90O8 — CID 177246649
ethane;[3-methyl-5-(2-methylnonanoyloxy)phenyl] 2-methylnonanoate;[3-methyl-5-(2-methyloctanoyloxy)phenyl] 2-methyloctanoate (PubChem CID 177246649) has the molecular formula C54H90O8 and a molecular weight of 867.31 g/mol. Its IUPAC name is ethane;[3-methyl-5-(2-methylnonanoyloxy)phenyl] 2-methylnonanoate;[3-methyl-5-(2-methyloctanoyloxy)phenyl] 2-methyloctanoate.
| Compound Name | ethane;[3-methyl-5-(2-methylnonanoyloxy)phenyl] 2-methylnonanoate;[3-methyl-5-(2-methyloctanoyloxy)phenyl] 2-methyloctanoate |
|---|---|
| PubChem CID | 177246649 |
| Molecular Formula | C54H90O8 |
| Molecular Weight | 867.31 g/mol |
| Exact Mass | 866.66 |
| IUPAC Name | ethane;[3-methyl-5-(2-methylnonanoyloxy)phenyl] 2-methylnonanoate;[3-methyl-5-(2-methyloctanoyloxy)phenyl] 2-methyloctanoate |
| SMILES | CC.CCCCCCC(C)C(=O)Oc1cc(C)cc(OC(=O)C(C)CCCCCC)c1.CCCCCCCC(C)C(=O)Oc1cc(C)cc(OC(=O)C(C)CCCCCCC)c1 |
| InChI | InChI=1S/C27H44O4.C25H40O4.C2H6/c1-6-8-10-12-14-16-22(4)26(28)30-24-18-21(3)19-25(20-24)31-27(29)23(5)17-15-13-11-9-7-2;1-6-8-10-12-14-20(4)24(26)28-22-16-19(3)17-23(18-22)29-25(27)21(5)15-13-11-9-7-2;1-2/h18-20,22-23H,6-17H2,1-5H3;16-18,20-21H,6-15H2,1-5H3;1-2H3 |
| InChIKey | JTGRJYKECCHPRO-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.31 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|