About 4-methyloctanoyl nonanoate
4-methyloctanoyl nonanoate (PubChem CID 56983372) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is 4-methyloctanoyl nonanoate.
Molecular Properties
| Compound Name | 4-methyloctanoyl nonanoate |
| PubChem CID | 56983372 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 4-methyloctanoyl nonanoate |
| SMILES | CCCCCCCCC(=O)OC(=O)CCC(C)CCCC |
| InChI | InChI=1S/C18H34O3/c1-4-6-8-9-10-11-13-17(19)21-18(20)15-14-16(3)12-7-5-2/h16H,4-15H2,1-3H3 |
| InChIKey | UXKZNQODQOJZBO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-methyloctanoyl nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyloctanoyl nonanoate?
The IUPAC name of 4-methyloctanoyl nonanoate (CID 56983372) is 4-methyloctanoyl nonanoate.
What is the SMILES notation for 4-methyloctanoyl nonanoate?
The canonical SMILES for 4-methyloctanoyl nonanoate is CCCCCCCCC(=O)OC(=O)CCC(C)CCCC.
What is the InChIKey of 4-methyloctanoyl nonanoate?
The InChIKey is UXKZNQODQOJZBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O3/c1-4-6-8-9-10-11-13-17(19)21-18(20)15-14-16(3)12-7-5-2/h16H,4-15H2,1-3H3.
What are the key properties of 4-methyloctanoyl nonanoate?
4-methyloctanoyl nonanoate has a molecular weight of 298.47 g/mol, XLogP of 5.41, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyloctanoyl nonanoate is sourced from PubChem (CID 56983372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).