C35H52O5S2 — CID 89228524
3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-2-methyl-3-oxopropanoic acid (PubChem CID 89228524) has the molecular formula C35H52O5S2 and a molecular weight of 616.93 g/mol. Its IUPAC name is 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 89228524 |
| Molecular Formula | C35H52O5S2 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | 3-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-2-methyl-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)Oc1c(C(C)(C)C)cc(SC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C35H52O5S2/c1-20(29(37)38)30(39)40-28-25(33(8,9)10)18-22(19-26(28)34(11,12)13)42-35(14,15)41-21-16-23(31(2,3)4)27(36)24(17-21)32(5,6)7/h16-20,36H,1-15H3,(H,37,38) |
| InChIKey | SHXSHZJWBORUPG-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|