C33H52N2O3S2 — CID 11433273
2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-N'-hydroxyethanimidamide (PubChem CID 11433273) has the molecular formula C33H52N2O3S2 and a molecular weight of 588.92 g/mol. Its IUPAC name is 2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-N'-hydroxyethanimidamide.
| Compound Name | 2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 11433273 |
| Molecular Formula | C33H52N2O3S2 |
| Molecular Weight | 588.92 g/mol |
| Exact Mass | 588.34 |
| IUPAC Name | 2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]-N'-hydroxyethanimidamide |
| SMILES | CC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OC/C(N)=N/O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H52N2O3S2/c1-29(2,3)22-15-20(16-23(27(22)36)30(4,5)6)39-33(13,14)40-21-17-24(31(7,8)9)28(38-19-26(34)35-37)25(18-21)32(10,11)12/h15-18,36-37H,19H2,1-14H3,(H2,34,35) |
| InChIKey | WMEVKGSAFKCGJI-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.92 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|