C36H58O4S2 — CID 58593369
(2R,3R)-1-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]pentane-2,3-diol (PubChem CID 58593369) has the molecular formula C36H58O4S2 and a molecular weight of 618.99 g/mol. Its IUPAC name is (2R,3R)-1-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]pentane-2,3-diol.
| Compound Name | (2R,3R)-1-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]pentane-2,3-diol |
|---|---|
| PubChem CID | 58593369 |
| Molecular Formula | C36H58O4S2 |
| Molecular Weight | 618.99 g/mol |
| Exact Mass | 618.38 |
| IUPAC Name | (2R,3R)-1-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenoxy]pentane-2,3-diol |
| SMILES | CC[C@@H](O)[C@H](O)COc1c(C(C)(C)C)cc(SC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C36H58O4S2/c1-16-28(37)29(38)21-40-31-26(34(8,9)10)19-23(20-27(31)35(11,12)13)42-36(14,15)41-22-17-24(32(2,3)4)30(39)25(18-22)33(5,6)7/h17-20,28-29,37-39H,16,21H2,1-15H3/t28-,29-/m1/s1 |
| InChIKey | RYJCTDIXDHBPAS-FQLXRVMXSA-N |
| XLogP | 9.71 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.99 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|