C36H60O5S2 — CID 143139856
4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfanyl]phenoxy]butane-1,2,3-triol;ethane (PubChem CID 143139856) has the molecular formula C36H60O5S2 and a molecular weight of 637.01 g/mol. Its IUPAC name is 4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfanyl]phenoxy]butane-1,2,3-triol;ethane.
| Compound Name | 4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfanyl]phenoxy]butane-1,2,3-triol;ethane |
|---|---|
| PubChem CID | 143139856 |
| Molecular Formula | C36H60O5S2 |
| Molecular Weight | 637.01 g/mol |
| Exact Mass | 636.39 |
| IUPAC Name | 4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfanyl]phenoxy]butane-1,2,3-triol;ethane |
| SMILES | CC.CC(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OCC(O)C(O)CO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H54O5S2.C2H6/c1-20(40-21-14-23(31(2,3)4)29(38)24(15-21)32(5,6)7)41-22-16-25(33(8,9)10)30(26(17-22)34(11,12)13)39-19-28(37)27(36)18-35;1-2/h14-17,20,27-28,35-38H,18-19H2,1-13H3;1-2H3 |
| InChIKey | FIRCQDRVVFSSBI-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.01 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|