C34H54O4S2 — CID 143139859
(2S)-4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfanyl]phenoxy]butane-1,2-diol (PubChem CID 143139859) has the molecular formula C34H54O4S2 and a molecular weight of 590.94 g/mol. Its IUPAC name is (2S)-4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfanyl]phenoxy]butane-1,2-diol.
| Compound Name | (2S)-4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfanyl]phenoxy]butane-1,2-diol |
|---|---|
| PubChem CID | 143139859 |
| Molecular Formula | C34H54O4S2 |
| Molecular Weight | 590.94 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | (2S)-4-[2,6-ditert-butyl-4-[1-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfanyl]phenoxy]butane-1,2-diol |
| SMILES | CC(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(OCC[C@H](O)CO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H54O4S2/c1-21(39-23-16-25(31(2,3)4)29(37)26(17-23)32(5,6)7)40-24-18-27(33(8,9)10)30(28(19-24)34(11,12)13)38-15-14-22(36)20-35/h16-19,21-22,35-37H,14-15,20H2,1-13H3/t21?,22-/m0/s1 |
| InChIKey | KBBROSKZZBDJSJ-KEKNWZKVSA-N |
| XLogP | 8.93 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.94 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|