C17H25KO3S — CID 23687694
potassium 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropanoate (PubChem CID 23687694) has the molecular formula C17H25KO3S and a molecular weight of 348.55 g/mol. Its IUPAC name is potassium 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropanoate.
| Compound Name | potassium 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 23687694 |
| Molecular Formula | C17H25KO3S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | potassium 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropanoate |
| SMILES | CC(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)[O-].[K+] |
| InChI | InChI=1S/C17H26O3S.K/c1-10(15(19)20)21-11-8-12(16(2,3)4)14(18)13(9-11)17(5,6)7;/h8-10,18H,1-7H3,(H,19,20);/q;+1/p-1 |
| InChIKey | TUFCVBMECRJIFA-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |