C21H36O2S — CID 88502408
2,6-ditert-butyl-4-(3-hydroxyheptylsulfanyl)phenol (PubChem CID 88502408) has the molecular formula C21H36O2S and a molecular weight of 352.58 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(3-hydroxyheptylsulfanyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(3-hydroxyheptylsulfanyl)phenol |
|---|---|
| PubChem CID | 88502408 |
| Molecular Formula | C21H36O2S |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2,6-ditert-butyl-4-(3-hydroxyheptylsulfanyl)phenol |
| SMILES | CCCCC(O)CCSc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H36O2S/c1-8-9-10-15(22)11-12-24-16-13-17(20(2,3)4)19(23)18(14-16)21(5,6)7/h13-15,22-23H,8-12H2,1-7H3 |
| InChIKey | VWADGQULAWAYIH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |