C19H30O2S — CID 14989154
5-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpentan-2-one (PubChem CID 14989154) has the molecular formula C19H30O2S and a molecular weight of 322.51 g/mol. Its IUPAC name is 5-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpentan-2-one.
| Compound Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpentan-2-one |
|---|---|
| PubChem CID | 14989154 |
| Molecular Formula | C19H30O2S |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 5-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpentan-2-one |
| SMILES | CC(=O)CCCSc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30O2S/c1-13(20)9-8-10-22-14-11-15(18(2,3)4)17(21)16(12-14)19(5,6)7/h11-12,21H,8-10H2,1-7H3 |
| InChIKey | DDEAARJENPSOFU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|