About ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate
ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate (PubChem CID 14011801) has the molecular formula C20H32O4S2
and a molecular weight of 400.61 g/mol. Its IUPAC name is ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate |
| PubChem CID | 14011801 |
| Molecular Formula | C20H32O4S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate |
| SMILES | CCOC(=O)CS(=O)CCSc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H32O4S2/c1-8-24-17(21)13-26(23)10-9-25-14-11-15(19(2,3)4)18(22)16(12-14)20(5,6)7/h11-12,22H,8-10,13H2,1-7H3 |
| InChIKey | VSNXESOFGBZUCJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate?
The IUPAC name of ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate (CID 14011801) is ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate.
What is the SMILES notation for ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate?
The canonical SMILES for ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate is CCOC(=O)CS(=O)CCSc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate?
The InChIKey is VSNXESOFGBZUCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O4S2/c1-8-24-17(21)13-26(23)10-9-25-14-11-15(19(2,3)4)18(22)16(12-14)20(5,6)7/h11-12,22H,8-10,13H2,1-7H3.
What are the key properties of ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate?
ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate has a molecular weight of 400.61 g/mol, XLogP of 4.39, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethylsulfinyl]acetate is sourced from PubChem (CID 14011801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).