C32H46O4S6 — CID 18959052
(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylcarbonyldisulfanyl]ethyldisulfanyl]methanone (PubChem CID 18959052) has the molecular formula C32H46O4S6 and a molecular weight of 687.12 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylcarbonyldisulfanyl]ethyldisulfanyl]methanone.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylcarbonyldisulfanyl]ethyldisulfanyl]methanone |
|---|---|
| PubChem CID | 18959052 |
| Molecular Formula | C32H46O4S6 |
| Molecular Weight | 687.12 g/mol |
| Exact Mass | 686.17 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-[2-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylcarbonyldisulfanyl]ethyldisulfanyl]methanone |
| SMILES | CC(C)(C)c1cc(SC(=O)SSCCSSC(=O)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C32H46O4S6/c1-29(2,3)21-15-19(16-22(25(21)33)30(4,5)6)39-27(35)41-37-13-14-38-42-28(36)40-20-17-23(31(7,8)9)26(34)24(18-20)32(10,11)12/h15-18,33-34H,13-14H2,1-12H3 |
| InChIKey | BKQFXDPJFVULAU-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.12 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|