C26H36O5S — CID 19956264
2-[4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethoxy]phenoxy]-2-methylpropanoic acid (PubChem CID 19956264) has the molecular formula C26H36O5S and a molecular weight of 460.64 g/mol. Its IUPAC name is 2-[4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethoxy]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethoxy]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 19956264 |
| Molecular Formula | C26H36O5S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 2-[4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylethoxy]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(OCCSc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1)C(=O)O |
| InChI | InChI=1S/C26H36O5S/c1-24(2,3)20-15-19(16-21(22(20)27)25(4,5)6)32-14-13-30-17-9-11-18(12-10-17)31-26(7,8)23(28)29/h9-12,15-16,27H,13-14H2,1-8H3,(H,28,29) |
| InChIKey | RFGXFZNIDQWGTD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|