C29H40N2O5 — CID 22399088
2-[4-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-1-yl]phenoxy]-2-methylpropanoic acid (PubChem CID 22399088) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[4-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-1-yl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-1-yl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 22399088 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | 2-[4-[4-(3,5-ditert-butyl-4-hydroxybenzoyl)piperazin-1-yl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1ccc(N2CCN(C(=O)c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)CC2)cc1)C(=O)O |
| InChI | InChI=1S/C29H40N2O5/c1-27(2,3)22-17-19(18-23(24(22)32)28(4,5)6)25(33)31-15-13-30(14-16-31)20-9-11-21(12-10-20)36-29(7,8)26(34)35/h9-12,17-18,32H,13-16H2,1-8H3,(H,34,35) |
| InChIKey | VEBRRVUTPHPNLG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|