C33H51NO4 — CID 92844540
ethyl (2R)-2-amino-3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 92844540) has the molecular formula C33H51NO4 and a molecular weight of 525.77 g/mol. Its IUPAC name is ethyl (2R)-2-amino-3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | ethyl (2R)-2-amino-3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 92844540 |
| Molecular Formula | C33H51NO4 |
| Molecular Weight | 525.77 g/mol |
| Exact Mass | 525.38 |
| IUPAC Name | ethyl (2R)-2-amino-3,3-bis(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)[C@H](N)C(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H51NO4/c1-14-38-29(37)26(34)25(19-15-21(30(2,3)4)27(35)22(16-19)31(5,6)7)20-17-23(32(8,9)10)28(36)24(18-20)33(11,12)13/h15-18,25-26,35-36H,14,34H2,1-13H3/t26-/m1/s1 |
| InChIKey | IRXUOCSUSVKRCQ-AREMUKBSSA-N |
| XLogP | 7.31 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.77 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |