C20H33NO3S — CID 88599231
2-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutylamino]acetic acid (PubChem CID 88599231) has the molecular formula C20H33NO3S and a molecular weight of 367.56 g/mol. Its IUPAC name is 2-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutylamino]acetic acid.
| Compound Name | 2-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutylamino]acetic acid |
|---|---|
| PubChem CID | 88599231 |
| Molecular Formula | C20H33NO3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 2-[4-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutylamino]acetic acid |
| SMILES | CC(C)(C)c1cc(SCCCCNCC(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C20H33NO3S/c1-19(2,3)15-11-14(12-16(18(15)24)20(4,5)6)25-10-8-7-9-21-13-17(22)23/h11-12,21,24H,7-10,13H2,1-6H3,(H,22,23) |
| InChIKey | HPROCAKWVHOUQF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|