C26H46OS2 — CID 123478115
2-tert-butyl-4,6-bis(octylsulfanyl)phenol (PubChem CID 123478115) has the molecular formula C26H46OS2 and a molecular weight of 438.79 g/mol. Its IUPAC name is 2-tert-butyl-4,6-bis(octylsulfanyl)phenol.
| Compound Name | 2-tert-butyl-4,6-bis(octylsulfanyl)phenol |
|---|---|
| PubChem CID | 123478115 |
| Molecular Formula | C26H46OS2 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 2-tert-butyl-4,6-bis(octylsulfanyl)phenol |
| SMILES | CCCCCCCCSc1cc(SCCCCCCCC)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H46OS2/c1-6-8-10-12-14-16-18-28-22-20-23(26(3,4)5)25(27)24(21-22)29-19-17-15-13-11-9-7-2/h20-21,27H,6-19H2,1-5H3 |
| InChIKey | XJWFBRYJUMCRIF-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|