C20H32Cl2S2 — CID 71322457
1,4-dichloro-2,5-bis(heptylsulfanyl)benzene (PubChem CID 71322457) has the molecular formula C20H32Cl2S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1,4-dichloro-2,5-bis(heptylsulfanyl)benzene.
| Compound Name | 1,4-dichloro-2,5-bis(heptylsulfanyl)benzene |
|---|---|
| PubChem CID | 71322457 |
| Molecular Formula | C20H32Cl2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 1,4-dichloro-2,5-bis(heptylsulfanyl)benzene |
| SMILES | CCCCCCCSc1cc(Cl)c(SCCCCCCC)cc1Cl |
| InChI | InChI=1S/C20H32Cl2S2/c1-3-5-7-9-11-13-23-19-15-18(22)20(16-17(19)21)24-14-12-10-8-6-4-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | RHPJBZFQDZUGQB-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|