C38H64O2S2Si — CID 19088165
2,6-ditert-butyl-4-[[dibutyl-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylmethyl]silyl]methylsulfanyl]phenol (PubChem CID 19088165) has the molecular formula C38H64O2S2Si and a molecular weight of 645.15 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[dibutyl-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylmethyl]silyl]methylsulfanyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[dibutyl-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylmethyl]silyl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 19088165 |
| Molecular Formula | C38H64O2S2Si |
| Molecular Weight | 645.15 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | 2,6-ditert-butyl-4-[[dibutyl-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylmethyl]silyl]methylsulfanyl]phenol |
| SMILES | CCCC[Si](CCCC)(CSc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)CSc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H64O2S2Si/c1-15-17-19-43(20-18-16-2,25-41-27-21-29(35(3,4)5)33(39)30(22-27)36(6,7)8)26-42-28-23-31(37(9,10)11)34(40)32(24-28)38(12,13)14/h21-24,39-40H,15-20,25-26H2,1-14H3 |
| InChIKey | RKUOLVKCORKCPU-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.15 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|