C31H50O2SSi — CID 91302127
2,6-ditert-butyl-4-[[dibutyl-(2-ethoxyphenyl)silyl]methylsulfanyl]phenol (PubChem CID 91302127) has the molecular formula C31H50O2SSi and a molecular weight of 514.89 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[dibutyl-(2-ethoxyphenyl)silyl]methylsulfanyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[dibutyl-(2-ethoxyphenyl)silyl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 91302127 |
| Molecular Formula | C31H50O2SSi |
| Molecular Weight | 514.89 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | 2,6-ditert-butyl-4-[[dibutyl-(2-ethoxyphenyl)silyl]methylsulfanyl]phenol |
| SMILES | CCCC[Si](CCCC)(CSc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1ccccc1OCC |
| InChI | InChI=1S/C31H50O2SSi/c1-10-13-19-35(20-14-11-2,28-18-16-15-17-27(28)33-12-3)23-34-24-21-25(30(4,5)6)29(32)26(22-24)31(7,8)9/h15-18,21-22,32H,10-14,19-20,23H2,1-9H3 |
| InChIKey | CJJZFSTXTGWEGL-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.89 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|