C23H29NO2S2 — CID 21474688
4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]-2,6-ditert-butylphenol (PubChem CID 21474688) has the molecular formula C23H29NO2S2 and a molecular weight of 415.62 g/mol. Its IUPAC name is 4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 21474688 |
| Molecular Formula | C23H29NO2S2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-[2-(1,3-benzoxazol-2-ylsulfanyl)ethylsulfanyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(SCCSc2nc3ccccc3o2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H29NO2S2/c1-22(2,3)16-13-15(14-17(20(16)25)23(4,5)6)27-11-12-28-21-24-18-9-7-8-10-19(18)26-21/h7-10,13-14,25H,11-12H2,1-6H3 |
| InChIKey | KXJYAHGTLJLKJE-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|