C14H20N2O2S — CID 106811625
3-(aminomethyl)-6-(1,3-benzoxazol-2-ylsulfanyl)hexan-3-ol (PubChem CID 106811625) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-(aminomethyl)-6-(1,3-benzoxazol-2-ylsulfanyl)hexan-3-ol.
| Compound Name | 3-(aminomethyl)-6-(1,3-benzoxazol-2-ylsulfanyl)hexan-3-ol |
|---|---|
| PubChem CID | 106811625 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3-(aminomethyl)-6-(1,3-benzoxazol-2-ylsulfanyl)hexan-3-ol |
| SMILES | CCC(O)(CN)CCCSc1nc2ccccc2o1 |
| InChI | InChI=1S/C14H20N2O2S/c1-2-14(17,10-15)8-5-9-19-13-16-11-6-3-4-7-12(11)18-13/h3-4,6-7,17H,2,5,8-10,15H2,1H3 |
| InChIKey | XOPDUZUKYQCSIA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|