C30H48O2SSi — CID 91433800
2,6-ditert-butyl-4-[[(2-methoxyphenyl)-bis(2-methylpropyl)silyl]methylsulfanyl]phenol (PubChem CID 91433800) has the molecular formula C30H48O2SSi and a molecular weight of 500.87 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[(2-methoxyphenyl)-bis(2-methylpropyl)silyl]methylsulfanyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[(2-methoxyphenyl)-bis(2-methylpropyl)silyl]methylsulfanyl]phenol |
|---|---|
| PubChem CID | 91433800 |
| Molecular Formula | C30H48O2SSi |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 2,6-ditert-butyl-4-[[(2-methoxyphenyl)-bis(2-methylpropyl)silyl]methylsulfanyl]phenol |
| SMILES | COc1ccccc1[Si](CSc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C30H48O2SSi/c1-21(2)18-34(19-22(3)4,27-15-13-12-14-26(27)32-11)20-33-23-16-24(29(5,6)7)28(31)25(17-23)30(8,9)10/h12-17,21-22,31H,18-20H2,1-11H3 |
| InChIKey | UHXIBNMHKZOZAV-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|