C23H33NO2 — CID 19960491
4-[2-(2-amino-3-methoxyphenyl)ethyl]-2,6-ditert-butylphenol (PubChem CID 19960491) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is 4-[2-(2-amino-3-methoxyphenyl)ethyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[2-(2-amino-3-methoxyphenyl)ethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 19960491 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 4-[2-(2-amino-3-methoxyphenyl)ethyl]-2,6-ditert-butylphenol |
| SMILES | COc1cccc(CCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1N |
| InChI | InChI=1S/C23H33NO2/c1-22(2,3)17-13-15(14-18(21(17)25)23(4,5)6)11-12-16-9-8-10-19(26-7)20(16)24/h8-10,13-14,25H,11-12,24H2,1-7H3 |
| InChIKey | CZMGKAUCOBBTRA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|