C30H38N2O2 — CID 19960543
1-benzyl-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]urea (PubChem CID 19960543) has the molecular formula C30H38N2O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 1-benzyl-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]urea.
| Compound Name | 1-benzyl-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 19960543 |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 1-benzyl-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(CCc2ccccc2NC(=O)NCc2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H38N2O2/c1-29(2,3)24-18-22(19-25(27(24)33)30(4,5)6)16-17-23-14-10-11-15-26(23)32-28(34)31-20-21-12-8-7-9-13-21/h7-15,18-19,33H,16-17,20H2,1-6H3,(H2,31,32,34) |
| InChIKey | WXHZQFDDGOMSEX-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |