C33H48N2O2 — CID 54098239
1-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]-3-(3,7-dimethylocta-2,6-dienyl)urea (PubChem CID 54098239) has the molecular formula C33H48N2O2 and a molecular weight of 504.76 g/mol. Its IUPAC name is 1-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]-3-(3,7-dimethylocta-2,6-dienyl)urea.
| Compound Name | 1-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]-3-(3,7-dimethylocta-2,6-dienyl)urea |
|---|---|
| PubChem CID | 54098239 |
| Molecular Formula | C33H48N2O2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.37 |
| IUPAC Name | 1-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]-3-(3,7-dimethylocta-2,6-dienyl)urea |
| SMILES | CC(C)=CCCC(C)=CCNC(=O)Nc1ccccc1CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H48N2O2/c1-23(2)13-12-14-24(3)19-20-34-31(37)35-29-16-11-10-15-26(29)18-17-25-21-27(32(4,5)6)30(36)28(22-25)33(7,8)9/h10-11,13,15-16,19,21-22,36H,12,14,17-18,20H2,1-9H3,(H2,34,35,37) |
| InChIKey | MYRHIWOCXHBXMT-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|