C39H44N2O2 — CID 19960522
1-(anthracen-9-ylmethyl)-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]-1-methylurea (PubChem CID 19960522) has the molecular formula C39H44N2O2 and a molecular weight of 572.79 g/mol. Its IUPAC name is 1-(anthracen-9-ylmethyl)-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]-1-methylurea.
| Compound Name | 1-(anthracen-9-ylmethyl)-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 19960522 |
| Molecular Formula | C39H44N2O2 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 1-(anthracen-9-ylmethyl)-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]-1-methylurea |
| SMILES | CN(Cc1c2ccccc2cc2ccccc12)C(=O)Nc1ccccc1CCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C39H44N2O2/c1-38(2,3)33-22-26(23-34(36(33)42)39(4,5)6)20-21-27-14-10-13-19-35(27)40-37(43)41(7)25-32-30-17-11-8-15-28(30)24-29-16-9-12-18-31(29)32/h8-19,22-24,42H,20-21,25H2,1-7H3,(H,40,43) |
| InChIKey | DPSNIFMWHVZGPJ-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|