C35H52N2O2 — CID 19960650
1,1-dicyclohexyl-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]urea (PubChem CID 19960650) has the molecular formula C35H52N2O2 and a molecular weight of 532.81 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]urea.
| Compound Name | 1,1-dicyclohexyl-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]urea |
|---|---|
| PubChem CID | 19960650 |
| Molecular Formula | C35H52N2O2 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.40 |
| IUPAC Name | 1,1-dicyclohexyl-3-[2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenyl]urea |
| SMILES | CC(C)(C)c1cc(CCc2ccccc2NC(=O)N(C2CCCCC2)C2CCCCC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C35H52N2O2/c1-34(2,3)29-23-25(24-30(32(29)38)35(4,5)6)21-22-26-15-13-14-20-31(26)36-33(39)37(27-16-9-7-10-17-27)28-18-11-8-12-19-28/h13-15,20,23-24,27-28,38H,7-12,16-19,21-22H2,1-6H3,(H,36,39) |
| InChIKey | KZGBRRXYVPCZAE-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |