C33H40F2N2O2 — CID 88613035
1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-(2,4-difluorophenyl)-1-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)urea (PubChem CID 88613035) has the molecular formula C33H40F2N2O2 and a molecular weight of 534.69 g/mol. Its IUPAC name is 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-(2,4-difluorophenyl)-1-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)urea.
| Compound Name | 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-(2,4-difluorophenyl)-1-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)urea |
|---|---|
| PubChem CID | 88613035 |
| Molecular Formula | C33H40F2N2O2 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-3-(2,4-difluorophenyl)-1-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)urea |
| SMILES | CC(C)(C)c1cc(CN(C(=O)Nc2ccc(F)cc2F)C2CCCc3ccccc3C2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C33H40F2N2O2/c1-32(2,3)26-16-21(17-27(30(26)38)33(4,5)6)20-37(31(39)36-29-15-14-24(34)19-28(29)35)25-13-9-12-22-10-7-8-11-23(22)18-25/h7-8,10-11,14-17,19,25,38H,9,12-13,18,20H2,1-6H3,(H,36,39) |
| InChIKey | QQJHWHJNIJBCAX-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |