C23H20F2N2OS — CID 70370266
1-benzyl-3-(2,4-difluorophenyl)-1-(3,4-dihydro-2H-thiochromen-4-yl)urea (PubChem CID 70370266) has the molecular formula C23H20F2N2OS and a molecular weight of 410.49 g/mol. Its IUPAC name is 1-benzyl-3-(2,4-difluorophenyl)-1-(3,4-dihydro-2H-thiochromen-4-yl)urea.
| Compound Name | 1-benzyl-3-(2,4-difluorophenyl)-1-(3,4-dihydro-2H-thiochromen-4-yl)urea |
|---|---|
| PubChem CID | 70370266 |
| Molecular Formula | C23H20F2N2OS |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1-benzyl-3-(2,4-difluorophenyl)-1-(3,4-dihydro-2H-thiochromen-4-yl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)N(Cc1ccccc1)C1CCSc2ccccc21 |
| InChI | InChI=1S/C23H20F2N2OS/c24-17-10-11-20(19(25)14-17)26-23(28)27(15-16-6-2-1-3-7-16)21-12-13-29-22-9-5-4-8-18(21)22/h1-11,14,21H,12-13,15H2,(H,26,28) |
| InChIKey | BEJKBIOZIWVVHY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |