C19H21F2N3O3 — CID 10833427
(2S)-2-[benzyl-[(2,4-difluorophenyl)carbamoyl]amino]-N-hydroxy-3-methylbutanamide (PubChem CID 10833427) has the molecular formula C19H21F2N3O3 and a molecular weight of 377.39 g/mol. Its IUPAC name is (2S)-2-[benzyl-[(2,4-difluorophenyl)carbamoyl]amino]-N-hydroxy-3-methylbutanamide.
| Compound Name | (2S)-2-[benzyl-[(2,4-difluorophenyl)carbamoyl]amino]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 10833427 |
| Molecular Formula | C19H21F2N3O3 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (2S)-2-[benzyl-[(2,4-difluorophenyl)carbamoyl]amino]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)NO)N(Cc1ccccc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H21F2N3O3/c1-12(2)17(18(25)23-27)24(11-13-6-4-3-5-7-13)19(26)22-16-9-8-14(20)10-15(16)21/h3-10,12,17,27H,11H2,1-2H3,(H,22,26)(H,23,25)/t17-/m0/s1 |
| InChIKey | ULQGFGPGBFHXLI-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|