C20H22F2N2OS — CID 139263929
N-benzyl-N-[1-(2,4-difluoroanilino)-3-methyl-1-sulfanylidenebutan-2-yl]acetamide (PubChem CID 139263929) has the molecular formula C20H22F2N2OS and a molecular weight of 376.47 g/mol. Its IUPAC name is N-benzyl-N-[1-(2,4-difluoroanilino)-3-methyl-1-sulfanylidenebutan-2-yl]acetamide.
| Compound Name | N-benzyl-N-[1-(2,4-difluoroanilino)-3-methyl-1-sulfanylidenebutan-2-yl]acetamide |
|---|---|
| PubChem CID | 139263929 |
| Molecular Formula | C20H22F2N2OS |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-benzyl-N-[1-(2,4-difluoroanilino)-3-methyl-1-sulfanylidenebutan-2-yl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)C(C(=S)Nc1ccc(F)cc1F)C(C)C |
| InChI | InChI=1S/C20H22F2N2OS/c1-13(2)19(20(26)23-18-10-9-16(21)11-17(18)22)24(14(3)25)12-15-7-5-4-6-8-15/h4-11,13,19H,12H2,1-3H3,(H,23,26) |
| InChIKey | ZSOQFGUNOQYHTA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|