C19H22N2O2S — CID 110894883
1-benzyl-3-(3,4-dihydro-2H-thiochromen-4-yl)-1-(2-hydroxyethyl)urea (PubChem CID 110894883) has the molecular formula C19H22N2O2S and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dihydro-2H-thiochromen-4-yl)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-benzyl-3-(3,4-dihydro-2H-thiochromen-4-yl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 110894883 |
| Molecular Formula | C19H22N2O2S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-benzyl-3-(3,4-dihydro-2H-thiochromen-4-yl)-1-(2-hydroxyethyl)urea |
| SMILES | O=C(NC1CCSc2ccccc21)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O2S/c22-12-11-21(14-15-6-2-1-3-7-15)19(23)20-17-10-13-24-18-9-5-4-8-16(17)18/h1-9,17,22H,10-14H2,(H,20,23) |
| InChIKey | HCIJKXGXRITJNH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |