C15H19FN2O2S — CID 111424120
3-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-hydroxyethyl)-1-prop-2-enylurea (PubChem CID 111424120) has the molecular formula C15H19FN2O2S and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-hydroxyethyl)-1-prop-2-enylurea.
| Compound Name | 3-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-hydroxyethyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 111424120 |
| Molecular Formula | C15H19FN2O2S |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-(6-fluoro-3,4-dihydro-2H-thiochromen-4-yl)-1-(2-hydroxyethyl)-1-prop-2-enylurea |
| SMILES | C=CCN(CCO)C(=O)NC1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C15H19FN2O2S/c1-2-6-18(7-8-19)15(20)17-13-5-9-21-14-4-3-11(16)10-12(13)14/h2-4,10,13,19H,1,5-9H2,(H,17,20) |
| InChIKey | ZYGUXXUVORODFN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|