C17H22F2N2O3 — CID 111424275
3-[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1-(2-hydroxyethyl)-1-prop-2-enylurea (PubChem CID 111424275) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is 3-[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1-(2-hydroxyethyl)-1-prop-2-enylurea.
| Compound Name | 3-[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1-(2-hydroxyethyl)-1-prop-2-enylurea |
|---|---|
| PubChem CID | 111424275 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-[6-(difluoromethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1-(2-hydroxyethyl)-1-prop-2-enylurea |
| SMILES | C=CCN(CCO)C(=O)NC1CCCc2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C17H22F2N2O3/c1-2-8-21(9-10-22)17(23)20-15-5-3-4-12-11-13(24-16(18)19)6-7-14(12)15/h2,6-7,11,15-16,22H,1,3-5,8-10H2,(H,20,23) |
| InChIKey | QYDUVIZASNINAA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|