C22H31NO3 — CID 25106251
4-hydroxy-3-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoic acid (PubChem CID 25106251) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is 4-hydroxy-3-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoic acid.
| Compound Name | 4-hydroxy-3-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoic acid |
|---|---|
| PubChem CID | 25106251 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 4-hydroxy-3-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]amino]benzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CNc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C22H31NO3/c1-16(2)7-5-8-17(3)9-6-10-18(4)13-14-23-20-15-19(22(25)26)11-12-21(20)24/h7,9,11-13,15,23-24H,5-6,8,10,14H2,1-4H3,(H,25,26)/b17-9+,18-13+ |
| InChIKey | KXRSQQAUAGHDRL-IJUJUXHTSA-N |
| XLogP | 5.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|