C17H22O3 — CID 54274018
4-(3,7-dimethylocta-2,6-dienoxy)benzoic acid (PubChem CID 54274018) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienoxy)benzoic acid.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienoxy)benzoic acid |
|---|---|
| PubChem CID | 54274018 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienoxy)benzoic acid |
| SMILES | CC(C)=CCCC(C)=CCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H22O3/c1-13(2)5-4-6-14(3)11-12-20-16-9-7-15(8-10-16)17(18)19/h5,7-11H,4,6,12H2,1-3H3,(H,18,19) |
| InChIKey | RMDHZUUXNBGDEM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|