C19H22O4 — CID 54108801
6-(3,7-dimethylocta-2,6-dienoxy)-1-benzofuran-2-carboxylic acid (PubChem CID 54108801) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 6-(3,7-dimethylocta-2,6-dienoxy)-1-benzofuran-2-carboxylic acid.
| Compound Name | 6-(3,7-dimethylocta-2,6-dienoxy)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 54108801 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 6-(3,7-dimethylocta-2,6-dienoxy)-1-benzofuran-2-carboxylic acid |
| SMILES | CC(C)=CCCC(C)=CCOc1ccc2cc(C(=O)O)oc2c1 |
| InChI | InChI=1S/C19H22O4/c1-13(2)5-4-6-14(3)9-10-22-16-8-7-15-11-18(19(20)21)23-17(15)12-16/h5,7-9,11-12H,4,6,10H2,1-3H3,(H,20,21) |
| InChIKey | NFPYDWZFQPTWFA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|