C24H30O4 — CID 163036218
7-[(8R)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one (PubChem CID 163036218) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 7-[(8R)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one.
| Compound Name | 7-[(8R)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one |
|---|---|
| PubChem CID | 163036218 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 7-[(8R)-8-hydroxy-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one |
| SMILES | CC(C)=CC[C@@H](O)C(C)=CCCC(C)=CCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C24H30O4/c1-17(2)8-12-22(25)19(4)7-5-6-18(3)14-15-27-21-11-9-20-10-13-24(26)28-23(20)16-21/h7-11,13-14,16,22,25H,5-6,12,15H2,1-4H3/t22-/m1/s1 |
| InChIKey | DXGDVCRVUSHMLW-JOCHJYFZSA-N |
| XLogP | 5.56 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|