C24H32O6 — CID 162810605
7-[(10S,11S)-10,11,12-trihydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]chromen-2-one (PubChem CID 162810605) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is 7-[(10S,11S)-10,11,12-trihydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]chromen-2-one.
| Compound Name | 7-[(10S,11S)-10,11,12-trihydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]chromen-2-one |
|---|---|
| PubChem CID | 162810605 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 7-[(10S,11S)-10,11,12-trihydroxy-3,7,11-trimethyldodeca-2,6-dienoxy]chromen-2-one |
| SMILES | CC(=CCOc1ccc2ccc(=O)oc2c1)CCC=C(C)CC[C@H](O)[C@@](C)(O)CO |
| InChI | InChI=1S/C24H32O6/c1-17(7-11-22(26)24(3,28)16-25)5-4-6-18(2)13-14-29-20-10-8-19-9-12-23(27)30-21(19)15-20/h5,8-10,12-13,15,22,25-26,28H,4,6-7,11,14,16H2,1-3H3/t22-,24-/m0/s1 |
| InChIKey | HJHZTWIWIGULGO-UPVQGACJSA-N |
| XLogP | 3.73 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|